C21H34N4O3Si — CID 69179366
[4-[(3-aminoquinolin-4-yl)amino]-5-[tert-butyl(dimethyl)silyl]oxypentyl]carbamic acid (PubChem CID 69179366) has the molecular formula C21H34N4O3Si and a molecular weight of 418.61 g/mol. Its IUPAC name is [4-[(3-aminoquinolin-4-yl)amino]-5-[tert-butyl(dimethyl)silyl]oxypentyl]carbamic acid.
| Compound Name | [4-[(3-aminoquinolin-4-yl)amino]-5-[tert-butyl(dimethyl)silyl]oxypentyl]carbamic acid |
|---|---|
| PubChem CID | 69179366 |
| Molecular Formula | C21H34N4O3Si |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.24 |
| IUPAC Name | [4-[(3-aminoquinolin-4-yl)amino]-5-[tert-butyl(dimethyl)silyl]oxypentyl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC(CCCNC(=O)O)Nc1c(N)cnc2ccccc12 |
| InChI | InChI=1S/C21H34N4O3Si/c1-21(2,3)29(4,5)28-14-15(9-8-12-23-20(26)27)25-19-16-10-6-7-11-18(16)24-13-17(19)22/h6-7,10-11,13,15,23H,8-9,12,14,22H2,1-5H3,(H,24,25)(H,26,27) |
| InChIKey | GKPNZXNPNMJLNU-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|