C19H21N3O — CID 162715623
4-N-[(2R)-1-methoxy-3-phenylpropan-2-yl]quinoline-3,4-diamine (PubChem CID 162715623) has the molecular formula C19H21N3O and a molecular weight of 307.40 g/mol. Its IUPAC name is 4-N-[(2R)-1-methoxy-3-phenylpropan-2-yl]quinoline-3,4-diamine.
| Compound Name | 4-N-[(2R)-1-methoxy-3-phenylpropan-2-yl]quinoline-3,4-diamine |
|---|---|
| PubChem CID | 162715623 |
| Molecular Formula | C19H21N3O |
| Molecular Weight | 307.40 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 4-N-[(2R)-1-methoxy-3-phenylpropan-2-yl]quinoline-3,4-diamine |
| SMILES | COC[C@@H](Cc1ccccc1)Nc1c(N)cnc2ccccc12 |
| InChI | InChI=1S/C19H21N3O/c1-23-13-15(11-14-7-3-2-4-8-14)22-19-16-9-5-6-10-18(16)21-12-17(19)20/h2-10,12,15H,11,13,20H2,1H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | QEUKGSCKSZXOTL-OAHLLOKOSA-N |
| XLogP | 3.49 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.40 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |