C21H24N4O2 — CID 66620004
[(4R)-4-[(3-aminoquinolin-4-yl)amino]-1-phenylpentan-2-yl]carbamic acid (PubChem CID 66620004) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is [(4R)-4-[(3-aminoquinolin-4-yl)amino]-1-phenylpentan-2-yl]carbamic acid.
| Compound Name | [(4R)-4-[(3-aminoquinolin-4-yl)amino]-1-phenylpentan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 66620004 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | [(4R)-4-[(3-aminoquinolin-4-yl)amino]-1-phenylpentan-2-yl]carbamic acid |
| SMILES | C[C@H](CC(Cc1ccccc1)NC(=O)O)Nc1c(N)cnc2ccccc12 |
| InChI | InChI=1S/C21H24N4O2/c1-14(11-16(25-21(26)27)12-15-7-3-2-4-8-15)24-20-17-9-5-6-10-19(17)23-13-18(20)22/h2-10,13-14,16,25H,11-12,22H2,1H3,(H,23,24)(H,26,27)/t14-,16?/m1/s1 |
| InChIKey | RXEHQKLDQKUVGQ-IURRXHLWSA-N |
| XLogP | 3.89 |
| TPSA | 100.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |