C17H25N3O — CID 156777884
4-N-[(2S)-1-ethoxy-3,3-dimethylbutan-2-yl]quinoline-3,4-diamine (PubChem CID 156777884) has the molecular formula C17H25N3O and a molecular weight of 287.41 g/mol. Its IUPAC name is 4-N-[(2S)-1-ethoxy-3,3-dimethylbutan-2-yl]quinoline-3,4-diamine.
| Compound Name | 4-N-[(2S)-1-ethoxy-3,3-dimethylbutan-2-yl]quinoline-3,4-diamine |
|---|---|
| PubChem CID | 156777884 |
| Molecular Formula | C17H25N3O |
| Molecular Weight | 287.41 g/mol |
| Exact Mass | 287.20 |
| IUPAC Name | 4-N-[(2S)-1-ethoxy-3,3-dimethylbutan-2-yl]quinoline-3,4-diamine |
| SMILES | CCOC[C@@H](Nc1c(N)cnc2ccccc12)C(C)(C)C |
| InChI | InChI=1S/C17H25N3O/c1-5-21-11-15(17(2,3)4)20-16-12-8-6-7-9-14(12)19-10-13(16)18/h6-10,15H,5,11,18H2,1-4H3,(H,19,20)/t15-/m1/s1 |
| InChIKey | ZYRBGWBIBFOJAX-OAHLLOKOSA-N |
| XLogP | 3.68 |
| TPSA | 60.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.41 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |