C18H23ClN4O6 — CID 146455539
(5-nitroquinolin-8-yl) 2-[(2-amino-4-methylpentanoyl)amino]propaneperoxoate;hydrochloride (PubChem CID 146455539) has the molecular formula C18H23ClN4O6 and a molecular weight of 426.86 g/mol. Its IUPAC name is (5-nitroquinolin-8-yl) 2-[(2-amino-4-methylpentanoyl)amino]propaneperoxoate;hydrochloride.
| Compound Name | (5-nitroquinolin-8-yl) 2-[(2-amino-4-methylpentanoyl)amino]propaneperoxoate;hydrochloride |
|---|---|
| PubChem CID | 146455539 |
| Molecular Formula | C18H23ClN4O6 |
| Molecular Weight | 426.86 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | (5-nitroquinolin-8-yl) 2-[(2-amino-4-methylpentanoyl)amino]propaneperoxoate;hydrochloride |
| SMILES | CC(C)CC(N)C(=O)NC(C)C(=O)OOc1ccc([N+](=O)[O-])c2cccnc12.Cl |
| InChI | InChI=1S/C18H22N4O6.ClH/c1-10(2)9-13(19)17(23)21-11(3)18(24)28-27-15-7-6-14(22(25)26)12-5-4-8-20-16(12)15;/h4-8,10-11,13H,9,19H2,1-3H3,(H,21,23);1H |
| InChIKey | WQSVXTZFRUZQKK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 146.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.86 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|