About methyl (5-nitroquinolin-8-yl) hydrogen phosphate
methyl (5-nitroquinolin-8-yl) hydrogen phosphate (PubChem CID 146455565) has the molecular formula C10H9N2O6P
and a molecular weight of 284.16 g/mol. Its IUPAC name is methyl (5-nitroquinolin-8-yl) hydrogen phosphate.
Molecular Properties
| Compound Name | methyl (5-nitroquinolin-8-yl) hydrogen phosphate |
| PubChem CID | 146455565 |
| Molecular Formula | C10H9N2O6P |
| Molecular Weight | 284.16 g/mol |
| Exact Mass | 284.02 |
| IUPAC Name | methyl (5-nitroquinolin-8-yl) hydrogen phosphate |
| SMILES | COP(=O)(O)Oc1ccc([N+](=O)[O-])c2cccnc12 |
| InChI | InChI=1S/C10H9N2O6P/c1-17-19(15,16)18-9-5-4-8(12(13)14)7-3-2-6-11-10(7)9/h2-6H,1H3,(H,15,16) |
| InChIKey | MLPRQFCATYVBAR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 111.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.16 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze methyl (5-nitroquinolin-8-yl) hydrogen phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (5-nitroquinolin-8-yl) hydrogen phosphate?
The IUPAC name of methyl (5-nitroquinolin-8-yl) hydrogen phosphate (CID 146455565) is methyl (5-nitroquinolin-8-yl) hydrogen phosphate.
What is the SMILES notation for methyl (5-nitroquinolin-8-yl) hydrogen phosphate?
The canonical SMILES for methyl (5-nitroquinolin-8-yl) hydrogen phosphate is COP(=O)(O)Oc1ccc([N+](=O)[O-])c2cccnc12.
What is the InChIKey of methyl (5-nitroquinolin-8-yl) hydrogen phosphate?
The InChIKey is MLPRQFCATYVBAR-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N2O6P/c1-17-19(15,16)18-9-5-4-8(12(13)14)7-3-2-6-11-10(7)9/h2-6H,1H3,(H,15,16).
What are the key properties of methyl (5-nitroquinolin-8-yl) hydrogen phosphate?
methyl (5-nitroquinolin-8-yl) hydrogen phosphate has a molecular weight of 284.16 g/mol, XLogP of 2.27, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (5-nitroquinolin-8-yl) hydrogen phosphate is sourced from PubChem (CID 146455565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).