C16H15N3O6 — CID 120528257
4-hydroxy-1-(5-nitroquinoline-8-carbonyl)piperidine-4-carboxylic acid (PubChem CID 120528257) has the molecular formula C16H15N3O6 and a molecular weight of 345.31 g/mol. Its IUPAC name is 4-hydroxy-1-(5-nitroquinoline-8-carbonyl)piperidine-4-carboxylic acid.
| Compound Name | 4-hydroxy-1-(5-nitroquinoline-8-carbonyl)piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 120528257 |
| Molecular Formula | C16H15N3O6 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.10 |
| IUPAC Name | 4-hydroxy-1-(5-nitroquinoline-8-carbonyl)piperidine-4-carboxylic acid |
| SMILES | O=C(c1ccc([N+](=O)[O-])c2cccnc12)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C16H15N3O6/c20-14(18-8-5-16(23,6-9-18)15(21)22)11-3-4-12(19(24)25)10-2-1-7-17-13(10)11/h1-4,7,23H,5-6,8-9H2,(H,21,22) |
| InChIKey | MOXKBXTXAXLIED-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 133.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|