C20H18N2O4 — CID 120528096
1-(benzo[f]quinoline-5-carbonyl)-4-hydroxypiperidine-4-carboxylic acid (PubChem CID 120528096) has the molecular formula C20H18N2O4 and a molecular weight of 350.37 g/mol. Its IUPAC name is 1-(benzo[f]quinoline-5-carbonyl)-4-hydroxypiperidine-4-carboxylic acid.
| Compound Name | 1-(benzo[f]quinoline-5-carbonyl)-4-hydroxypiperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 120528096 |
| Molecular Formula | C20H18N2O4 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 1-(benzo[f]quinoline-5-carbonyl)-4-hydroxypiperidine-4-carboxylic acid |
| SMILES | O=C(c1cc2ccccc2c2cccnc12)N1CCC(O)(C(=O)O)CC1 |
| InChI | InChI=1S/C20H18N2O4/c23-18(22-10-7-20(26,8-11-22)19(24)25)16-12-13-4-1-2-5-14(13)15-6-3-9-21-17(15)16/h1-6,9,12,26H,7-8,10-11H2,(H,24,25) |
| InChIKey | HCCKENRIPBNSRE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 90.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|