C26H20F3N3O2 — CID 55785012
[4-(benzo[f]quinoline-5-carbonyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 55785012) has the molecular formula C26H20F3N3O2 and a molecular weight of 463.46 g/mol. Its IUPAC name is [4-(benzo[f]quinoline-5-carbonyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(benzo[f]quinoline-5-carbonyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 55785012 |
| Molecular Formula | C26H20F3N3O2 |
| Molecular Weight | 463.46 g/mol |
| Exact Mass | 463.15 |
| IUPAC Name | [4-(benzo[f]quinoline-5-carbonyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CCN(C(=O)c2cc3ccccc3c3cccnc23)CC1 |
| InChI | InChI=1S/C26H20F3N3O2/c27-26(28,29)19-7-3-6-18(15-19)24(33)31-11-13-32(14-12-31)25(34)22-16-17-5-1-2-8-20(17)21-9-4-10-30-23(21)22/h1-10,15-16H,11-14H2 |
| InChIKey | GKDJHPHKZZQHPZ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.46 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|