C24H28N4O2 — CID 55762083
2-[4-(benzo[f]quinoline-5-carbonyl)piperazin-1-yl]-N-butan-2-ylacetamide (PubChem CID 55762083) has the molecular formula C24H28N4O2 and a molecular weight of 404.51 g/mol. Its IUPAC name is 2-[4-(benzo[f]quinoline-5-carbonyl)piperazin-1-yl]-N-butan-2-ylacetamide.
| Compound Name | 2-[4-(benzo[f]quinoline-5-carbonyl)piperazin-1-yl]-N-butan-2-ylacetamide |
|---|---|
| PubChem CID | 55762083 |
| Molecular Formula | C24H28N4O2 |
| Molecular Weight | 404.51 g/mol |
| Exact Mass | 404.22 |
| IUPAC Name | 2-[4-(benzo[f]quinoline-5-carbonyl)piperazin-1-yl]-N-butan-2-ylacetamide |
| SMILES | CCC(C)NC(=O)CN1CCN(C(=O)c2cc3ccccc3c3cccnc23)CC1 |
| InChI | InChI=1S/C24H28N4O2/c1-3-17(2)26-22(29)16-27-11-13-28(14-12-27)24(30)21-15-18-7-4-5-8-19(18)20-9-6-10-25-23(20)21/h4-10,15,17H,3,11-14,16H2,1-2H3,(H,26,29) |
| InChIKey | DUHFETGRGAEEPB-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.51 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|