C19H21Cl2N3O — CID 119579435
benzo[f]quinolin-5-yl-(3-methylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 119579435) has the molecular formula C19H21Cl2N3O and a molecular weight of 378.30 g/mol. Its IUPAC name is benzo[f]quinolin-5-yl-(3-methylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | benzo[f]quinolin-5-yl-(3-methylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119579435 |
| Molecular Formula | C19H21Cl2N3O |
| Molecular Weight | 378.30 g/mol |
| Exact Mass | 377.11 |
| IUPAC Name | benzo[f]quinolin-5-yl-(3-methylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | CC1CN(C(=O)c2cc3ccccc3c3cccnc23)CCN1.Cl.Cl |
| InChI | InChI=1S/C19H19N3O.2ClH/c1-13-12-22(10-9-20-13)19(23)17-11-14-5-2-3-6-15(14)16-7-4-8-21-18(16)17;;/h2-8,11,13,20H,9-10,12H2,1H3;2*1H |
| InChIKey | JYAIQFMVQNMDBD-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.30 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|