C14H17Cl2FN4O — CID 119578005
(7-fluoroquinoxalin-5-yl)-(3-methylpiperazin-1-yl)methanone;dihydrochloride (PubChem CID 119578005) has the molecular formula C14H17Cl2FN4O and a molecular weight of 347.22 g/mol. Its IUPAC name is (7-fluoroquinoxalin-5-yl)-(3-methylpiperazin-1-yl)methanone;dihydrochloride.
| Compound Name | (7-fluoroquinoxalin-5-yl)-(3-methylpiperazin-1-yl)methanone;dihydrochloride |
|---|---|
| PubChem CID | 119578005 |
| Molecular Formula | C14H17Cl2FN4O |
| Molecular Weight | 347.22 g/mol |
| Exact Mass | 346.08 |
| IUPAC Name | (7-fluoroquinoxalin-5-yl)-(3-methylpiperazin-1-yl)methanone;dihydrochloride |
| SMILES | CC1CN(C(=O)c2cc(F)cc3nccnc23)CCN1.Cl.Cl |
| InChI | InChI=1S/C14H15FN4O.2ClH/c1-9-8-19(5-4-16-9)14(20)11-6-10(15)7-12-13(11)18-3-2-17-12;;/h2-3,6-7,9,16H,4-5,8H2,1H3;2*1H |
| InChIKey | TWXBHRSNVSODLH-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 58.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.22 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |