C13H15FN4O — CID 119576176
(6-fluoro-1H-benzimidazol-4-yl)-(3-methylpiperazin-1-yl)methanone (PubChem CID 119576176) has the molecular formula C13H15FN4O and a molecular weight of 262.29 g/mol. Its IUPAC name is (6-fluoro-1H-benzimidazol-4-yl)-(3-methylpiperazin-1-yl)methanone.
| Compound Name | (6-fluoro-1H-benzimidazol-4-yl)-(3-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 119576176 |
| Molecular Formula | C13H15FN4O |
| Molecular Weight | 262.29 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | (6-fluoro-1H-benzimidazol-4-yl)-(3-methylpiperazin-1-yl)methanone |
| SMILES | CC1CN(C(=O)c2cc(F)cc3[nH]cnc23)CCN1 |
| InChI | InChI=1S/C13H15FN4O/c1-8-6-18(3-2-15-8)13(19)10-4-9(14)5-11-12(10)17-7-16-11/h4-5,7-8,15H,2-3,6H2,1H3,(H,16,17) |
| InChIKey | LPCDNCTVYLQFDL-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.29 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |