C22H17ClF3N3O2 — CID 55785069
[4-(2-chloroquinoline-4-carbonyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone (PubChem CID 55785069) has the molecular formula C22H17ClF3N3O2 and a molecular weight of 447.84 g/mol. Its IUPAC name is [4-(2-chloroquinoline-4-carbonyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone.
| Compound Name | [4-(2-chloroquinoline-4-carbonyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone |
|---|---|
| PubChem CID | 55785069 |
| Molecular Formula | C22H17ClF3N3O2 |
| Molecular Weight | 447.84 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | [4-(2-chloroquinoline-4-carbonyl)piperazin-1-yl]-[3-(trifluoromethyl)phenyl]methanone |
| SMILES | O=C(c1cccc(C(F)(F)F)c1)N1CCN(C(=O)c2cc(Cl)nc3ccccc23)CC1 |
| InChI | InChI=1S/C22H17ClF3N3O2/c23-19-13-17(16-6-1-2-7-18(16)27-19)21(31)29-10-8-28(9-11-29)20(30)14-4-3-5-15(12-14)22(24,25)26/h1-7,12-13H,8-11H2 |
| InChIKey | YSUSGLSQBMSABZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.84 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|