C23H28ClN3O2 — CID 55917218
1-[4-(2-chloroquinoline-4-carbonyl)piperazin-1-yl]-3-cyclohexylpropan-1-one (PubChem CID 55917218) has the molecular formula C23H28ClN3O2 and a molecular weight of 413.95 g/mol. Its IUPAC name is 1-[4-(2-chloroquinoline-4-carbonyl)piperazin-1-yl]-3-cyclohexylpropan-1-one.
| Compound Name | 1-[4-(2-chloroquinoline-4-carbonyl)piperazin-1-yl]-3-cyclohexylpropan-1-one |
|---|---|
| PubChem CID | 55917218 |
| Molecular Formula | C23H28ClN3O2 |
| Molecular Weight | 413.95 g/mol |
| Exact Mass | 413.19 |
| IUPAC Name | 1-[4-(2-chloroquinoline-4-carbonyl)piperazin-1-yl]-3-cyclohexylpropan-1-one |
| SMILES | O=C(CCC1CCCCC1)N1CCN(C(=O)c2cc(Cl)nc3ccccc23)CC1 |
| InChI | InChI=1S/C23H28ClN3O2/c24-21-16-19(18-8-4-5-9-20(18)25-21)23(29)27-14-12-26(13-15-27)22(28)11-10-17-6-2-1-3-7-17/h4-5,8-9,16-17H,1-3,6-7,10-15H2 |
| InChIKey | JLOYSCJWSMNGFU-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.95 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|