C22H34N6O5 — CID 23908602
1-acetyl-N-(2-aminoethyl)-4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]pyrrolidine-2-carboxamide (PubChem CID 23908602) has the molecular formula C22H34N6O5 and a molecular weight of 462.55 g/mol. Its IUPAC name is 1-acetyl-N-(2-aminoethyl)-4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]pyrrolidine-2-carboxamide.
| Compound Name | 1-acetyl-N-(2-aminoethyl)-4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23908602 |
| Molecular Formula | C22H34N6O5 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.26 |
| IUPAC Name | 1-acetyl-N-(2-aminoethyl)-4-[2-morpholin-4-ylethyl-[(4-nitrophenyl)methyl]amino]pyrrolidine-2-carboxamide |
| SMILES | CC(=O)N1CC(N(CCN2CCOCC2)Cc2ccc([N+](=O)[O-])cc2)CC1C(=O)NCCN |
| InChI | InChI=1S/C22H34N6O5/c1-17(29)27-16-20(14-21(27)22(30)24-7-6-23)26(9-8-25-10-12-33-13-11-25)15-18-2-4-19(5-3-18)28(31)32/h2-5,20-21H,6-16,23H2,1H3,(H,24,30) |
| InChIKey | LGPMEGOCACVYAU-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 134.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|