C23H29N5O4S — CID 23885279
(2R)-N-(2-aminoethyl)-4-[cyclopropyl-[(4-nitrophenyl)methyl]amino]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide (PubChem CID 23885279) has the molecular formula C23H29N5O4S and a molecular weight of 471.58 g/mol. Its IUPAC name is (2R)-N-(2-aminoethyl)-4-[cyclopropyl-[(4-nitrophenyl)methyl]amino]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide.
| Compound Name | (2R)-N-(2-aminoethyl)-4-[cyclopropyl-[(4-nitrophenyl)methyl]amino]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
|---|---|
| PubChem CID | 23885279 |
| Molecular Formula | C23H29N5O4S |
| Molecular Weight | 471.58 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | (2R)-N-(2-aminoethyl)-4-[cyclopropyl-[(4-nitrophenyl)methyl]amino]-1-(thiophene-2-carbonyl)piperidine-2-carboxamide |
| SMILES | NCCNC(=O)[C@H]1CC(N(Cc2ccc([N+](=O)[O-])cc2)C2CC2)CCN1C(=O)c1cccs1 |
| InChI | InChI=1S/C23H29N5O4S/c24-10-11-25-22(29)20-14-19(9-12-26(20)23(30)21-2-1-13-33-21)27(17-7-8-17)15-16-3-5-18(6-4-16)28(31)32/h1-6,13,17,19-20H,7-12,14-15,24H2,(H,25,29)/t19?,20-/m1/s1 |
| InChIKey | JGXSMCAHZCELNX-GFOWMXPYSA-N |
| XLogP | 2.37 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.58 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|