C26H28FN5O4S — CID 23732167
N-(2-aminoethyl)-1-(4-fluorobenzoyl)-4-[(4-nitrophenyl)methyl-(thiophen-2-ylmethyl)amino]pyrrolidine-2-carboxamide (PubChem CID 23732167) has the molecular formula C26H28FN5O4S and a molecular weight of 525.61 g/mol. Its IUPAC name is N-(2-aminoethyl)-1-(4-fluorobenzoyl)-4-[(4-nitrophenyl)methyl-(thiophen-2-ylmethyl)amino]pyrrolidine-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-1-(4-fluorobenzoyl)-4-[(4-nitrophenyl)methyl-(thiophen-2-ylmethyl)amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23732167 |
| Molecular Formula | C26H28FN5O4S |
| Molecular Weight | 525.61 g/mol |
| Exact Mass | 525.18 |
| IUPAC Name | N-(2-aminoethyl)-1-(4-fluorobenzoyl)-4-[(4-nitrophenyl)methyl-(thiophen-2-ylmethyl)amino]pyrrolidine-2-carboxamide |
| SMILES | NCCNC(=O)C1CC(N(Cc2ccc([N+](=O)[O-])cc2)Cc2cccs2)CN1C(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C26H28FN5O4S/c27-20-7-5-19(6-8-20)26(34)31-16-22(14-24(31)25(33)29-12-11-28)30(17-23-2-1-13-37-23)15-18-3-9-21(10-4-18)32(35)36/h1-10,13,22,24H,11-12,14-17,28H2,(H,29,33) |
| InChIKey | LRHIWIAXOFXPEA-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.61 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|