C27H31N5O4S — CID 23764765
N-(2-aminoethyl)-4-[(4-nitrophenyl)methyl-(2-phenylethyl)amino]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide (PubChem CID 23764765) has the molecular formula C27H31N5O4S and a molecular weight of 521.64 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-[(4-nitrophenyl)methyl-(2-phenylethyl)amino]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-4-[(4-nitrophenyl)methyl-(2-phenylethyl)amino]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23764765 |
| Molecular Formula | C27H31N5O4S |
| Molecular Weight | 521.64 g/mol |
| Exact Mass | 521.21 |
| IUPAC Name | N-(2-aminoethyl)-4-[(4-nitrophenyl)methyl-(2-phenylethyl)amino]-1-(thiophene-2-carbonyl)pyrrolidine-2-carboxamide |
| SMILES | NCCNC(=O)C1CC(N(CCc2ccccc2)Cc2ccc([N+](=O)[O-])cc2)CN1C(=O)c1cccs1 |
| InChI | InChI=1S/C27H31N5O4S/c28-13-14-29-26(33)24-17-23(19-31(24)27(34)25-7-4-16-37-25)30(15-12-20-5-2-1-3-6-20)18-21-8-10-22(11-9-21)32(35)36/h1-11,16,23-24H,12-15,17-19,28H2,(H,29,33) |
| InChIKey | ULHMAJJGYRIZSH-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 521.64 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|