C30H39N5O4 — CID 23988309
N-(4-aminocyclohexyl)-1-(cyclopropanecarbonyl)-4-[(4-nitrophenyl)methyl-(2-phenylethyl)amino]pyrrolidine-2-carboxamide (PubChem CID 23988309) has the molecular formula C30H39N5O4 and a molecular weight of 533.67 g/mol. Its IUPAC name is N-(4-aminocyclohexyl)-1-(cyclopropanecarbonyl)-4-[(4-nitrophenyl)methyl-(2-phenylethyl)amino]pyrrolidine-2-carboxamide.
| Compound Name | N-(4-aminocyclohexyl)-1-(cyclopropanecarbonyl)-4-[(4-nitrophenyl)methyl-(2-phenylethyl)amino]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 23988309 |
| Molecular Formula | C30H39N5O4 |
| Molecular Weight | 533.67 g/mol |
| Exact Mass | 533.30 |
| IUPAC Name | N-(4-aminocyclohexyl)-1-(cyclopropanecarbonyl)-4-[(4-nitrophenyl)methyl-(2-phenylethyl)amino]pyrrolidine-2-carboxamide |
| SMILES | NC1CCC(NC(=O)C2CC(N(CCc3ccccc3)Cc3ccc([N+](=O)[O-])cc3)CN2C(=O)C2CC2)CC1 |
| InChI | InChI=1S/C30H39N5O4/c31-24-10-12-25(13-11-24)32-29(36)28-18-27(20-34(28)30(37)23-8-9-23)33(17-16-21-4-2-1-3-5-21)19-22-6-14-26(15-7-22)35(38)39/h1-7,14-15,23-25,27-28H,8-13,16-20,31H2,(H,32,36) |
| InChIKey | RZJQQZDISXNVJG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 121.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.67 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|