C18H31N2O3P — CID 23884738
[4-[[(4-aminocyclohexyl)-(2-methylpropyl)amino]methyl]phenyl]methylphosphonic acid (PubChem CID 23884738) has the molecular formula C18H31N2O3P and a molecular weight of 354.43 g/mol. Its IUPAC name is [4-[[(4-aminocyclohexyl)-(2-methylpropyl)amino]methyl]phenyl]methylphosphonic acid.
| Compound Name | [4-[[(4-aminocyclohexyl)-(2-methylpropyl)amino]methyl]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 23884738 |
| Molecular Formula | C18H31N2O3P |
| Molecular Weight | 354.43 g/mol |
| Exact Mass | 354.21 |
| IUPAC Name | [4-[[(4-aminocyclohexyl)-(2-methylpropyl)amino]methyl]phenyl]methylphosphonic acid |
| SMILES | CC(C)CN(Cc1ccc(CP(=O)(O)O)cc1)C1CCC(N)CC1 |
| InChI | InChI=1S/C18H31N2O3P/c1-14(2)11-20(18-9-7-17(19)8-10-18)12-15-3-5-16(6-4-15)13-24(21,22)23/h3-6,14,17-18H,7-13,19H2,1-2H3,(H2,21,22,23) |
| InChIKey | MNAXXSMDOSMVQJ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.43 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|