C24H35N2O3P — CID 23967358
[4-[[(4-aminocyclohexyl)-[(4-propan-2-ylphenyl)methyl]amino]methyl]phenyl]methylphosphonic acid (PubChem CID 23967358) has the molecular formula C24H35N2O3P and a molecular weight of 430.53 g/mol. Its IUPAC name is [4-[[(4-aminocyclohexyl)-[(4-propan-2-ylphenyl)methyl]amino]methyl]phenyl]methylphosphonic acid.
| Compound Name | [4-[[(4-aminocyclohexyl)-[(4-propan-2-ylphenyl)methyl]amino]methyl]phenyl]methylphosphonic acid |
|---|---|
| PubChem CID | 23967358 |
| Molecular Formula | C24H35N2O3P |
| Molecular Weight | 430.53 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | [4-[[(4-aminocyclohexyl)-[(4-propan-2-ylphenyl)methyl]amino]methyl]phenyl]methylphosphonic acid |
| SMILES | CC(C)c1ccc(CN(Cc2ccc(CP(=O)(O)O)cc2)C2CCC(N)CC2)cc1 |
| InChI | InChI=1S/C24H35N2O3P/c1-18(2)22-9-7-20(8-10-22)16-26(24-13-11-23(25)12-14-24)15-19-3-5-21(6-4-19)17-30(27,28)29/h3-10,18,23-24H,11-17,25H2,1-2H3,(H2,27,28,29) |
| InChIKey | XWFYYJOHGNBNTP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.53 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|