C18H24BrFO4 — CID 91730110
1-O-[(2-bromo-5-fluorophenyl)methyl] 4-O-(2-methylhexan-3-yl) butanedioate (PubChem CID 91730110) has the molecular formula C18H24BrFO4 and a molecular weight of 403.29 g/mol. Its IUPAC name is 1-O-[(2-bromo-5-fluorophenyl)methyl] 4-O-(2-methylhexan-3-yl) butanedioate.
| Compound Name | 1-O-[(2-bromo-5-fluorophenyl)methyl] 4-O-(2-methylhexan-3-yl) butanedioate |
|---|---|
| PubChem CID | 91730110 |
| Molecular Formula | C18H24BrFO4 |
| Molecular Weight | 403.29 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 1-O-[(2-bromo-5-fluorophenyl)methyl] 4-O-(2-methylhexan-3-yl) butanedioate |
| SMILES | CCCC(OC(=O)CCC(=O)OCc1cc(F)ccc1Br)C(C)C |
| InChI | InChI=1S/C18H24BrFO4/c1-4-5-16(12(2)3)24-18(22)9-8-17(21)23-11-13-10-14(20)6-7-15(13)19/h6-7,10,12,16H,4-5,8-9,11H2,1-3H3 |
| InChIKey | FJWSWSYYXHIHQB-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.29 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |