C13H14F2N4O3S3 — CID 121029682
N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[methyl(methylsulfonyl)amino]acetamide (PubChem CID 121029682) has the molecular formula C13H14F2N4O3S3 and a molecular weight of 408.48 g/mol. Its IUPAC name is N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[methyl(methylsulfonyl)amino]acetamide.
| Compound Name | N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[methyl(methylsulfonyl)amino]acetamide |
|---|---|
| PubChem CID | 121029682 |
| Molecular Formula | C13H14F2N4O3S3 |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.02 |
| IUPAC Name | N-[5-[(2,5-difluorophenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-2-[methyl(methylsulfonyl)amino]acetamide |
| SMILES | CN(CC(=O)Nc1nnc(SCc2cc(F)ccc2F)s1)S(C)(=O)=O |
| InChI | InChI=1S/C13H14F2N4O3S3/c1-19(25(2,21)22)6-11(20)16-12-17-18-13(24-12)23-7-8-5-9(14)3-4-10(8)15/h3-5H,6-7H2,1-2H3,(H,16,17,20) |
| InChIKey | MUTLXBXCYWWMRI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|