C14H15N5O5S3 — CID 20949424
N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonyl]amino]acetamide (PubChem CID 20949424) has the molecular formula C14H15N5O5S3 and a molecular weight of 429.51 g/mol. Its IUPAC name is N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonyl]amino]acetamide.
| Compound Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonyl]amino]acetamide |
|---|---|
| PubChem CID | 20949424 |
| Molecular Formula | C14H15N5O5S3 |
| Molecular Weight | 429.51 g/mol |
| Exact Mass | 429.02 |
| IUPAC Name | N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-2-[methyl-[(2-oxo-3H-1,3-benzoxazol-6-yl)sulfonyl]amino]acetamide |
| SMILES | CCSc1nnc(NC(=O)CN(C)S(=O)(=O)c2ccc3[nH]c(=O)oc3c2)s1 |
| InChI | InChI=1S/C14H15N5O5S3/c1-3-25-14-18-17-12(26-14)16-11(20)7-19(2)27(22,23)8-4-5-9-10(6-8)24-13(21)15-9/h4-6H,3,7H2,1-2H3,(H,15,21)(H,16,17,20) |
| InChIKey | IGTGWEKMGFSDRA-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 138.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.51 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|