C17H21N5O5S3 — CID 50808436
2-[(2,6-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl-methylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide (PubChem CID 50808436) has the molecular formula C17H21N5O5S3 and a molecular weight of 471.59 g/mol. Its IUPAC name is 2-[(2,6-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl-methylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide.
| Compound Name | 2-[(2,6-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl-methylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
|---|---|
| PubChem CID | 50808436 |
| Molecular Formula | C17H21N5O5S3 |
| Molecular Weight | 471.59 g/mol |
| Exact Mass | 471.07 |
| IUPAC Name | 2-[(2,6-dimethyl-3-oxo-4H-1,4-benzoxazin-7-yl)sulfonyl-methylamino]-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)acetamide |
| SMILES | CCSc1nnc(NC(=O)CN(C)S(=O)(=O)c2cc3c(cc2C)NC(=O)C(C)O3)s1 |
| InChI | InChI=1S/C17H21N5O5S3/c1-5-28-17-21-20-16(29-17)19-14(23)8-22(4)30(25,26)13-7-12-11(6-9(13)2)18-15(24)10(3)27-12/h6-7,10H,5,8H2,1-4H3,(H,18,24)(H,19,20,23) |
| InChIKey | LGEJWZKVUUKDKA-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 130.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.59 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|