C17H24N4O6S — CID 20865972
2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(3-methoxypropyl)acetamide (PubChem CID 20865972) has the molecular formula C17H24N4O6S and a molecular weight of 412.47 g/mol. Its IUPAC name is 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(3-methoxypropyl)acetamide.
| Compound Name | 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(3-methoxypropyl)acetamide |
|---|---|
| PubChem CID | 20865972 |
| Molecular Formula | C17H24N4O6S |
| Molecular Weight | 412.47 g/mol |
| Exact Mass | 412.14 |
| IUPAC Name | 2-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonyl-methylamino]-N-(3-methoxypropyl)acetamide |
| SMILES | COCCCNC(=O)CN(C)S(=O)(=O)c1ccc2c(c1)c(=O)n(C)c(=O)n2C |
| InChI | InChI=1S/C17H24N4O6S/c1-19(11-15(22)18-8-5-9-27-4)28(25,26)12-6-7-14-13(10-12)16(23)21(3)17(24)20(14)2/h6-7,10H,5,8-9,11H2,1-4H3,(H,18,22) |
| InChIKey | XISCGXAIGVTXRA-UHFFFAOYSA-N |
| XLogP | -0.99 |
| TPSA | 119.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.47 |
| LogP ≤ 5 | -0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|