C22H30N4O5S — CID 53298133
N-cyclohexyl-3-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]-N-prop-2-enylpropanamide (PubChem CID 53298133) has the molecular formula C22H30N4O5S and a molecular weight of 462.57 g/mol. Its IUPAC name is N-cyclohexyl-3-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]-N-prop-2-enylpropanamide.
| Compound Name | N-cyclohexyl-3-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]-N-prop-2-enylpropanamide |
|---|---|
| PubChem CID | 53298133 |
| Molecular Formula | C22H30N4O5S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.19 |
| IUPAC Name | N-cyclohexyl-3-[(1,3-dimethyl-2,4-dioxoquinazolin-6-yl)sulfonylamino]-N-prop-2-enylpropanamide |
| SMILES | C=CCN(C(=O)CCNS(=O)(=O)c1ccc2c(c1)c(=O)n(C)c(=O)n2C)C1CCCCC1 |
| InChI | InChI=1S/C22H30N4O5S/c1-4-14-26(16-8-6-5-7-9-16)20(27)12-13-23-32(30,31)17-10-11-19-18(15-17)21(28)25(3)22(29)24(19)2/h4,10-11,15-16,23H,1,5-9,12-14H2,2-3H3 |
| InChIKey | IQMKTUDLEKLFOO-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 110.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|