C16H18NO4S2- — CID 59180411
3-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]thiophene-2-carboxylate (PubChem CID 59180411) has the molecular formula C16H18NO4S2- and a molecular weight of 352.46 g/mol. Its IUPAC name is 3-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]thiophene-2-carboxylate.
| Compound Name | 3-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 59180411 |
| Molecular Formula | C16H18NO4S2- |
| Molecular Weight | 352.46 g/mol |
| Exact Mass | 352.07 |
| IUPAC Name | 3-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]thiophene-2-carboxylate |
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)Nc2ccsc2C(=O)[O-])cc1 |
| InChI | InChI=1S/C16H19NO4S2/c1-4-16(2,3)11-5-7-12(8-6-11)23(20,21)17-13-9-10-22-14(13)15(18)19/h5-10,17H,4H2,1-3H3,(H,18,19)/p-1 |
| InChIKey | JYWBZJJSJLPAPA-UHFFFAOYSA-M |
| XLogP | 2.60 |
| TPSA | 86.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.46 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |