C26H29NO4S — CID 68688852
4-[2-[2-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 68688852) has the molecular formula C26H29NO4S and a molecular weight of 451.59 g/mol. Its IUPAC name is 4-[2-[2-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68688852 |
| Molecular Formula | C26H29NO4S |
| Molecular Weight | 451.59 g/mol |
| Exact Mass | 451.18 |
| IUPAC Name | 4-[2-[2-[[4-(2-methylbutan-2-yl)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)Nc2ccccc2CCc2ccc(C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C26H29NO4S/c1-4-26(2,3)22-15-17-23(18-16-22)32(30,31)27-24-8-6-5-7-20(24)12-9-19-10-13-21(14-11-19)25(28)29/h5-8,10-11,13-18,27H,4,9,12H2,1-3H3,(H,28,29) |
| InChIKey | DXIKYXSVDLZABZ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.59 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |