C27H30N2O5S — CID 68691450
4-[2-[2-[1-(4-acetamidophenyl)sulfonylbutylamino]phenyl]ethyl]benzoic acid (PubChem CID 68691450) has the molecular formula C27H30N2O5S and a molecular weight of 494.61 g/mol. Its IUPAC name is 4-[2-[2-[1-(4-acetamidophenyl)sulfonylbutylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[1-(4-acetamidophenyl)sulfonylbutylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 68691450 |
| Molecular Formula | C27H30N2O5S |
| Molecular Weight | 494.61 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | 4-[2-[2-[1-(4-acetamidophenyl)sulfonylbutylamino]phenyl]ethyl]benzoic acid |
| SMILES | CCCC(Nc1ccccc1CCc1ccc(C(=O)O)cc1)S(=O)(=O)c1ccc(NC(C)=O)cc1 |
| InChI | InChI=1S/C27H30N2O5S/c1-3-6-26(35(33,34)24-17-15-23(16-18-24)28-19(2)30)29-25-8-5-4-7-21(25)12-9-20-10-13-22(14-11-20)27(31)32/h4-5,7-8,10-11,13-18,26,29H,3,6,9,12H2,1-2H3,(H,28,30)(H,31,32) |
| InChIKey | IWBAWYPWOLZUCJ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 112.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.61 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |