C21H29NO2S — CID 3305277
4-(2-methylbutan-2-yl)-N-(4-phenylbutan-2-yl)benzenesulfonamide (PubChem CID 3305277) has the molecular formula C21H29NO2S and a molecular weight of 359.54 g/mol. Its IUPAC name is 4-(2-methylbutan-2-yl)-N-(4-phenylbutan-2-yl)benzenesulfonamide.
| Compound Name | 4-(2-methylbutan-2-yl)-N-(4-phenylbutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 3305277 |
| Molecular Formula | C21H29NO2S |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 4-(2-methylbutan-2-yl)-N-(4-phenylbutan-2-yl)benzenesulfonamide |
| SMILES | CCC(C)(C)c1ccc(S(=O)(=O)NC(C)CCc2ccccc2)cc1 |
| InChI | InChI=1S/C21H29NO2S/c1-5-21(3,4)19-13-15-20(16-14-19)25(23,24)22-17(2)11-12-18-9-7-6-8-10-18/h6-10,13-17,22H,5,11-12H2,1-4H3 |
| InChIKey | LNRFYABIDRJYTF-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |