C47H39F3N2O11S4 — CID 161124123
4-[2-[2-[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]ethyl]benzoic acid;4-[2-[2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid (PubChem CID 161124123) has the molecular formula C47H39F3N2O11S4 and a molecular weight of 993.09 g/mol. Its IUPAC name is 4-[2-[2-[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]ethyl]benzoic acid;4-[2-[2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid.
| Compound Name | 4-[2-[2-[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]ethyl]benzoic acid;4-[2-[2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid |
|---|---|
| PubChem CID | 161124123 |
| Molecular Formula | C47H39F3N2O11S4 |
| Molecular Weight | 993.09 g/mol |
| Exact Mass | 992.14 |
| IUPAC Name | 4-[2-[2-[[5-(benzenesulfonyl)thiophen-2-yl]sulfonylamino]phenyl]ethyl]benzoic acid;4-[2-[2-[[2-(trifluoromethoxy)phenyl]sulfonylamino]phenyl]ethyl]benzoic acid |
| SMILES | O=C(O)c1ccc(CCc2ccccc2NS(=O)(=O)c2ccc(S(=O)(=O)c3ccccc3)s2)cc1.O=C(O)c1ccc(CCc2ccccc2NS(=O)(=O)c2ccccc2OC(F)(F)F)cc1 |
| InChI | InChI=1S/C25H21NO6S3.C22H18F3NO5S/c27-25(28)20-14-11-18(12-15-20)10-13-19-6-4-5-9-22(19)26-35(31,32)24-17-16-23(33-24)34(29,30)21-7-2-1-3-8-21;23-22(24,25)31-19-7-3-4-8-20(19)32(29,30)26-18-6-2-1-5-16(18)12-9-15-10-13-17(14-11-15)21(27)28/h1-9,11-12,14-17,26H,10,13H2,(H,27,28);1-8,10-11,13-14,26H,9,12H2,(H,27,28) |
| InChIKey | ULIIVFGAXWJYLM-UHFFFAOYSA-N |
| XLogP | 9.73 |
| TPSA | 210.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 67 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 993.09 |
| LogP ≤ 5 | 9.73 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |