C24H15Br6N3O9S3 — CID 57257832
1-N,3-N,5-N-tris(2,6-dibromo-4-hydroxyphenyl)benzene-1,3,5-trisulfonamide (PubChem CID 57257832) has the molecular formula C24H15Br6N3O9S3 and a molecular weight of 1065.02 g/mol. Its IUPAC name is 1-N,3-N,5-N-tris(2,6-dibromo-4-hydroxyphenyl)benzene-1,3,5-trisulfonamide.
| Compound Name | 1-N,3-N,5-N-tris(2,6-dibromo-4-hydroxyphenyl)benzene-1,3,5-trisulfonamide |
|---|---|
| PubChem CID | 57257832 |
| Molecular Formula | C24H15Br6N3O9S3 |
| Molecular Weight | 1065.02 g/mol |
| Exact Mass | 1058.51 |
| IUPAC Name | 1-N,3-N,5-N-tris(2,6-dibromo-4-hydroxyphenyl)benzene-1,3,5-trisulfonamide |
| SMILES | O=S(=O)(Nc1c(Br)cc(O)cc1Br)c1cc(S(=O)(=O)Nc2c(Br)cc(O)cc2Br)cc(S(=O)(=O)Nc2c(Br)cc(O)cc2Br)c1 |
| InChI | InChI=1S/C24H15Br6N3O9S3/c25-16-1-10(34)2-17(26)22(16)31-43(37,38)13-7-14(44(39,40)32-23-18(27)3-11(35)4-19(23)28)9-15(8-13)45(41,42)33-24-20(29)5-12(36)6-21(24)30/h1-9,31-36H |
| InChIKey | LQLHRFNZMMGJCL-UHFFFAOYSA-N |
| XLogP | 7.78 |
| TPSA | 199.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1065.02 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'sulfonamide_B(41)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|