C13H10N2O4S2 — CID 43426242
3-[[4-(cyanomethyl)phenyl]sulfamoyl]thiophene-2-carboxylic acid (PubChem CID 43426242) has the molecular formula C13H10N2O4S2 and a molecular weight of 322.37 g/mol. Its IUPAC name is 3-[[4-(cyanomethyl)phenyl]sulfamoyl]thiophene-2-carboxylic acid.
| Compound Name | 3-[[4-(cyanomethyl)phenyl]sulfamoyl]thiophene-2-carboxylic acid |
|---|---|
| PubChem CID | 43426242 |
| Molecular Formula | C13H10N2O4S2 |
| Molecular Weight | 322.37 g/mol |
| Exact Mass | 322.01 |
| IUPAC Name | 3-[[4-(cyanomethyl)phenyl]sulfamoyl]thiophene-2-carboxylic acid |
| SMILES | N#CCc1ccc(NS(=O)(=O)c2ccsc2C(=O)O)cc1 |
| InChI | InChI=1S/C13H10N2O4S2/c14-7-5-9-1-3-10(4-2-9)15-21(18,19)11-6-8-20-12(11)13(16)17/h1-4,6,8,15H,5H2,(H,16,17) |
| InChIKey | UQRLHHFBNWFWBR-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 107.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.37 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |