C17H21BN2O3S — CID 123465393
N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole-4-carboxamide (PubChem CID 123465393) has the molecular formula C17H21BN2O3S and a molecular weight of 344.25 g/mol. Its IUPAC name is N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole-4-carboxamide.
| Compound Name | N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole-4-carboxamide |
|---|---|
| PubChem CID | 123465393 |
| Molecular Formula | C17H21BN2O3S |
| Molecular Weight | 344.25 g/mol |
| Exact Mass | 344.14 |
| IUPAC Name | N-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1,3-thiazole-4-carboxamide |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1NC(=O)c1cscn1 |
| InChI | InChI=1S/C17H21BN2O3S/c1-11-8-12(18-22-16(2,3)17(4,5)23-18)6-7-13(11)20-15(21)14-9-24-10-19-14/h6-10H,1-5H3,(H,20,21) |
| InChIKey | GACBQPUDOXPASU-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.25 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|