C26H30B2N4O7S2 — CID 159977669
4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;[4-(1,3-thiazole-4-carbonylamino)phenyl]boronic acid;1,3-thiazole-4-carboxylic acid (PubChem CID 159977669) has the molecular formula C26H30B2N4O7S2 and a molecular weight of 596.31 g/mol. Its IUPAC name is 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;[4-(1,3-thiazole-4-carbonylamino)phenyl]boronic acid;1,3-thiazole-4-carboxylic acid.
| Compound Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;[4-(1,3-thiazole-4-carbonylamino)phenyl]boronic acid;1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 159977669 |
| Molecular Formula | C26H30B2N4O7S2 |
| Molecular Weight | 596.31 g/mol |
| Exact Mass | 596.17 |
| IUPAC Name | 4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)aniline;[4-(1,3-thiazole-4-carbonylamino)phenyl]boronic acid;1,3-thiazole-4-carboxylic acid |
| SMILES | CC1(C)OB(c2ccc(N)cc2)OC1(C)C.O=C(Nc1ccc(B(O)O)cc1)c1cscn1.O=C(O)c1cscn1 |
| InChI | InChI=1S/C12H18BNO2.C10H9BN2O3S.C4H3NO2S/c1-11(2)12(3,4)16-13(15-11)9-5-7-10(14)8-6-9;14-10(9-5-17-6-12-9)13-8-3-1-7(2-4-8)11(15)16;6-4(7)3-1-8-2-5-3/h5-8H,14H2,1-4H3;1-6,15-16H,(H,13,14);1-2H,(H,6,7) |
| InChIKey | OFJAXVRTYJKHDL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 177.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|