C40H50B2N2O7S2 — CID 163635299
4-methylsulfanylaniline;N-(4-methylsulfanylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid (PubChem CID 163635299) has the molecular formula C40H50B2N2O7S2 and a molecular weight of 756.61 g/mol. Its IUPAC name is 4-methylsulfanylaniline;N-(4-methylsulfanylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid.
| Compound Name | 4-methylsulfanylaniline;N-(4-methylsulfanylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
|---|---|
| PubChem CID | 163635299 |
| Molecular Formula | C40H50B2N2O7S2 |
| Molecular Weight | 756.61 g/mol |
| Exact Mass | 756.32 |
| IUPAC Name | 4-methylsulfanylaniline;N-(4-methylsulfanylphenyl)-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide;4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzoic acid |
| SMILES | CC1(C)OB(c2ccc(C(=O)O)cc2)OC1(C)C.CSc1ccc(N)cc1.CSc1ccc(NC(=O)c2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C20H24BNO3S.C13H17BO4.C7H9NS/c1-19(2)20(3,4)25-21(24-19)15-8-6-14(7-9-15)18(23)22-16-10-12-17(26-5)13-11-16;1-12(2)13(3,4)18-14(17-12)10-7-5-9(6-8-10)11(15)16;1-9-7-4-2-6(8)3-5-7/h6-13H,1-5H3,(H,22,23);5-8H,1-4H3,(H,15,16);2-5H,8H2,1H3 |
| InChIKey | HZOPJQFGBOFPLV-UHFFFAOYSA-N |
| XLogP | 7.63 |
| TPSA | 129.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 756.61 |
| LogP ≤ 5 | 7.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|