C22H27BO3S — CID 163503565
1-(4-methylsulfanylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-one (PubChem CID 163503565) has the molecular formula C22H27BO3S and a molecular weight of 382.33 g/mol. Its IUPAC name is 1-(4-methylsulfanylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-one.
| Compound Name | 1-(4-methylsulfanylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-one |
|---|---|
| PubChem CID | 163503565 |
| Molecular Formula | C22H27BO3S |
| Molecular Weight | 382.33 g/mol |
| Exact Mass | 382.18 |
| IUPAC Name | 1-(4-methylsulfanylphenyl)-3-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]propan-2-one |
| SMILES | CSc1ccc(CC(=O)Cc2ccc(B3OC(C)(C)C(C)(C)O3)cc2)cc1 |
| InChI | InChI=1S/C22H27BO3S/c1-21(2)22(3,4)26-23(25-21)18-10-6-16(7-11-18)14-19(24)15-17-8-12-20(27-5)13-9-17/h6-13H,14-15H2,1-5H3 |
| InChIKey | RIGDLDGZQNKQJV-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.33 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|