C24H31BO3S — CID 159196633
3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propan-1-one (PubChem CID 159196633) has the molecular formula C24H31BO3S and a molecular weight of 410.39 g/mol. Its IUPAC name is 3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propan-1-one.
| Compound Name | 3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propan-1-one |
|---|---|
| PubChem CID | 159196633 |
| Molecular Formula | C24H31BO3S |
| Molecular Weight | 410.39 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 3-[2-methyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)propan-1-one |
| SMILES | Cc1cc(B2OC(C)(C)C(C)(C)O2)ccc1CCC(=O)c1cc2c(s1)CCCC2 |
| InChI | InChI=1S/C24H31BO3S/c1-16-14-19(25-27-23(2,3)24(4,5)28-25)12-10-17(16)11-13-20(26)22-15-18-8-6-7-9-21(18)29-22/h10,12,14-15H,6-9,11,13H2,1-5H3 |
| InChIKey | CDSGZKLQNHTXIP-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.39 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|