C22H26BFO3S — CID 58540359
2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethanone (PubChem CID 58540359) has the molecular formula C22H26BFO3S and a molecular weight of 400.32 g/mol. Its IUPAC name is 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethanone.
| Compound Name | 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethanone |
|---|---|
| PubChem CID | 58540359 |
| Molecular Formula | C22H26BFO3S |
| Molecular Weight | 400.32 g/mol |
| Exact Mass | 400.17 |
| IUPAC Name | 2-[2-fluoro-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]-1-(4,5,6,7-tetrahydro-1-benzothiophen-2-yl)ethanone |
| SMILES | CC1(C)OB(c2ccc(F)c(CC(=O)c3cc4c(s3)CCCC4)c2)OC1(C)C |
| InChI | InChI=1S/C22H26BFO3S/c1-21(2)22(3,4)27-23(26-21)16-9-10-17(24)15(11-16)12-18(25)20-13-14-7-5-6-8-19(14)28-20/h9-11,13H,5-8,12H2,1-4H3 |
| InChIKey | YKGZBQKDABDUOR-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.32 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|