C10H11Br2O2S- — CID 174751669
[4-bromo-2-(2-bromopropyl)phenyl]methanesulfinate (PubChem CID 174751669) has the molecular formula C10H11Br2O2S- and a molecular weight of 355.07 g/mol. Its IUPAC name is [4-bromo-2-(2-bromopropyl)phenyl]methanesulfinate.
| Compound Name | [4-bromo-2-(2-bromopropyl)phenyl]methanesulfinate |
|---|---|
| PubChem CID | 174751669 |
| Molecular Formula | C10H11Br2O2S- |
| Molecular Weight | 355.07 g/mol |
| Exact Mass | 352.89 |
| IUPAC Name | [4-bromo-2-(2-bromopropyl)phenyl]methanesulfinate |
| SMILES | CC(Br)Cc1cc(Br)ccc1CS(=O)[O-] |
| InChI | InChI=1S/C10H12Br2O2S/c1-7(11)4-9-5-10(12)3-2-8(9)6-15(13)14/h2-3,5,7H,4,6H2,1H3,(H,13,14)/p-1 |
| InChIKey | MHNFAZXRHJXIIG-UHFFFAOYSA-M |
| XLogP | 3.15 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.07 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|