C12H15ClN2 — CID 116641154
N-but-3-ynyl-1-(4-chlorophenyl)ethane-1,2-diamine (PubChem CID 116641154) has the molecular formula C12H15ClN2 and a molecular weight of 222.72 g/mol. Its IUPAC name is N-but-3-ynyl-1-(4-chlorophenyl)ethane-1,2-diamine.
| Compound Name | N-but-3-ynyl-1-(4-chlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116641154 |
| Molecular Formula | C12H15ClN2 |
| Molecular Weight | 222.72 g/mol |
| Exact Mass | 222.09 |
| IUPAC Name | N-but-3-ynyl-1-(4-chlorophenyl)ethane-1,2-diamine |
| SMILES | C#CCCNC(CN)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C12H15ClN2/c1-2-3-8-15-12(9-14)10-4-6-11(13)7-5-10/h1,4-7,12,15H,3,8-9,14H2 |
| InChIKey | JFEJKEZTSQEUCN-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.72 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|