C13H17ClN2O — CID 116641174
N-but-3-ynyl-1-(3-chloro-4-methoxyphenyl)ethane-1,2-diamine (PubChem CID 116641174) has the molecular formula C13H17ClN2O and a molecular weight of 252.74 g/mol. Its IUPAC name is N-but-3-ynyl-1-(3-chloro-4-methoxyphenyl)ethane-1,2-diamine.
| Compound Name | N-but-3-ynyl-1-(3-chloro-4-methoxyphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 116641174 |
| Molecular Formula | C13H17ClN2O |
| Molecular Weight | 252.74 g/mol |
| Exact Mass | 252.10 |
| IUPAC Name | N-but-3-ynyl-1-(3-chloro-4-methoxyphenyl)ethane-1,2-diamine |
| SMILES | C#CCCNC(CN)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C13H17ClN2O/c1-3-4-7-16-12(9-15)10-5-6-13(17-2)11(14)8-10/h1,5-6,8,12,16H,4,7,9,15H2,2H3 |
| InChIKey | JXDPWYPHZSLPFV-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.74 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|