C15H16Cl2N2 — CID 65383375
N-benzyl-1-(3,5-dichlorophenyl)ethane-1,2-diamine (PubChem CID 65383375) has the molecular formula C15H16Cl2N2 and a molecular weight of 295.21 g/mol. Its IUPAC name is N-benzyl-1-(3,5-dichlorophenyl)ethane-1,2-diamine.
| Compound Name | N-benzyl-1-(3,5-dichlorophenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65383375 |
| Molecular Formula | C15H16Cl2N2 |
| Molecular Weight | 295.21 g/mol |
| Exact Mass | 294.07 |
| IUPAC Name | N-benzyl-1-(3,5-dichlorophenyl)ethane-1,2-diamine |
| SMILES | NCC(NCc1ccccc1)c1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C15H16Cl2N2/c16-13-6-12(7-14(17)8-13)15(9-18)19-10-11-4-2-1-3-5-11/h1-8,15,19H,9-10,18H2 |
| InChIKey | YRXYQDFBFPJWPJ-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.21 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |