C16H19FN2 — CID 65385277
N-benzyl-1-(4-fluoro-2-methylphenyl)ethane-1,2-diamine (PubChem CID 65385277) has the molecular formula C16H19FN2 and a molecular weight of 258.34 g/mol. Its IUPAC name is N-benzyl-1-(4-fluoro-2-methylphenyl)ethane-1,2-diamine.
| Compound Name | N-benzyl-1-(4-fluoro-2-methylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65385277 |
| Molecular Formula | C16H19FN2 |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.15 |
| IUPAC Name | N-benzyl-1-(4-fluoro-2-methylphenyl)ethane-1,2-diamine |
| SMILES | Cc1cc(F)ccc1C(CN)NCc1ccccc1 |
| InChI | InChI=1S/C16H19FN2/c1-12-9-14(17)7-8-15(12)16(10-18)19-11-13-5-3-2-4-6-13/h2-9,16,19H,10-11,18H2,1H3 |
| InChIKey | DYEKHUPHGXKRDO-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |