C17H22N2 — CID 65385280
N-benzyl-1-(3,4-dimethylphenyl)ethane-1,2-diamine (PubChem CID 65385280) has the molecular formula C17H22N2 and a molecular weight of 254.38 g/mol. Its IUPAC name is N-benzyl-1-(3,4-dimethylphenyl)ethane-1,2-diamine.
| Compound Name | N-benzyl-1-(3,4-dimethylphenyl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 65385280 |
| Molecular Formula | C17H22N2 |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.18 |
| IUPAC Name | N-benzyl-1-(3,4-dimethylphenyl)ethane-1,2-diamine |
| SMILES | Cc1ccc(C(CN)NCc2ccccc2)cc1C |
| InChI | InChI=1S/C17H22N2/c1-13-8-9-16(10-14(13)2)17(11-18)19-12-15-6-4-3-5-7-15/h3-10,17,19H,11-12,18H2,1-2H3 |
| InChIKey | OJUOIBNXLDINGM-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |