C13H22N2 — CID 62070144
1-(3,4-dimethylphenyl)-N-propan-2-ylethane-1,2-diamine (PubChem CID 62070144) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-N-propan-2-ylethane-1,2-diamine.
| Compound Name | 1-(3,4-dimethylphenyl)-N-propan-2-ylethane-1,2-diamine |
|---|---|
| PubChem CID | 62070144 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-N-propan-2-ylethane-1,2-diamine |
| SMILES | Cc1ccc(C(CN)NC(C)C)cc1C |
| InChI | InChI=1S/C13H22N2/c1-9(2)15-13(8-14)12-6-5-10(3)11(4)7-12/h5-7,9,13,15H,8,14H2,1-4H3 |
| InChIKey | IBHINYBDKYDPNU-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |