C13H11F9N2O6S — CID 98618274
N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide (PubChem CID 98618274) has the molecular formula C13H11F9N2O6S and a molecular weight of 494.29 g/mol. Its IUPAC name is N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide.
| Compound Name | N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
|---|---|
| PubChem CID | 98618274 |
| Molecular Formula | C13H11F9N2O6S |
| Molecular Weight | 494.29 g/mol |
| Exact Mass | 494.02 |
| IUPAC Name | N-[(1R,2R)-1,3-dihydroxy-1-(4-nitrophenyl)propan-2-yl]-1,1,2,2,3,3,4,4,4-nonafluorobutane-1-sulfonamide |
| SMILES | O=[N+]([O-])c1ccc([C@@H](O)[C@@H](CO)NS(=O)(=O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H11F9N2O6S/c14-10(15,12(18,19)20)11(16,17)13(21,22)31(29,30)23-8(5-25)9(26)6-1-3-7(4-2-6)24(27)28/h1-4,8-9,23,25-26H,5H2/t8-,9-/m1/s1 |
| InChIKey | LZGNIXNFONWPDR-RKDXNWHRSA-N |
| XLogP | 2.33 |
| TPSA | 129.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.29 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|