C22H17F3N2O4S — CID 102462303
4-nitro-N-[(E,1R)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]benzenesulfonamide (PubChem CID 102462303) has the molecular formula C22H17F3N2O4S and a molecular weight of 462.45 g/mol. Its IUPAC name is 4-nitro-N-[(E,1R)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]benzenesulfonamide.
| Compound Name | 4-nitro-N-[(E,1R)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]benzenesulfonamide |
|---|---|
| PubChem CID | 102462303 |
| Molecular Formula | C22H17F3N2O4S |
| Molecular Weight | 462.45 g/mol |
| Exact Mass | 462.09 |
| IUPAC Name | 4-nitro-N-[(E,1R)-3-phenyl-1-[4-(trifluoromethyl)phenyl]prop-2-enyl]benzenesulfonamide |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N[C@H](/C=C/c2ccccc2)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C22H17F3N2O4S/c23-22(24,25)18-9-7-17(8-10-18)21(15-6-16-4-2-1-3-5-16)26-32(30,31)20-13-11-19(12-14-20)27(28)29/h1-15,21,26H/b15-6+/t21-/m1/s1 |
| InChIKey | UENGUCMAWSTJGC-YIDVQRCCSA-N |
| XLogP | 5.35 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.45 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|